Koester, Roland; Seidel, Guenter; Krueger, Carl; Mueller, Gerhard; Jiang, Anbei; Boese, Roland:

Boron compounds. 90. Cycloenantiomeric (ligand)transition metal p-complexes of organosubstituted 2,5-dihydro-1,2,5-azasilaborole compounds - characterization in the solid state.

In: Chemische Berichte (Chem.Ber.), Jg. 122 (1989) ; Nr. 11, S. 2075-2083
ISSN: 0009-2940
Zeitschriftenaufsatz / Fach: Chemie
Six title complexes contg. the ligand I were characterized by x-ray crystallog.: (OC)3Cr-h6-I (R1 = Ph, R2 = R3 = Me); the h4-cycloRS-enantiomers cycloS-CpCO-h4-I (R1 = H, R2 = Ph, R3 = Me; Cp = h5-cyclopentadienyl), cycloS-CpCo-h4-I-h6-Cr(CO)3 (R1 = Ph, R2 = R3 = Me), cycloR-C2H4IrCl-h4-I (R1 = R2 = R3 = Me); meso-(C2H4Rh-h1h4-I)2 (R1 = yl, R2 = R3 = Me), and meso-(Ni-h3h4-I)2 (R1 = R2 = Me, R3 = CMe:CH2).